corrinsmommie corrinsmommie

22-09-2021
Mathematics

contestada

1 tenth + 2 tenths Write the sum in standard form

Respuesta :

lilyAllen567 lilyAllen567

22-09-2021

Answer:

3 Tenths / 0.3

Step-by-step explanation:

you add 1+2 and get 3 then to put it in standard from you put the 3 in your tenths place in your decimal and a 0 in front of your point

Answer Link

Otras preguntas

Alten What must an author do to layer meaning into a text?

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3

The misleading use of a term with more than one meaning (by glossing over which meaning is intended at a particular time) ex: 1) A bird in the hand is worth two

Smoothing a time series of observations A. is a form of statistical cheating. B. allows statisticians to use less data than would otherwise be required. C. rend

Which of the following elements does not lose an electron easily? NA F MG AL

Alexis and Jessica are shopping. Alexis buys 4 pairs of pants and 3 necklaces and pays $216. Jessica buys 7 pairs of pants and 2 necklaces and pays $300. Solve

Write down the first 6 elements of the following sequence (where n ∈ Z +), then give a recursive definition for an. Do not forget the base case. (You do not nee

The monthly profit for a small company that makes long-sleeve T-shirts depends on the price per shirt. If the price is too high, sales will drop. If the price i

4. When the sexually assaulted becomes the sexually assaulter. You may remember allegations of 37 year-old Italian actress Asia Argento had sex with a then 17

Calculate the mass in grams for 0.251 moles of Na2CO3